C14H7F2NO2 — CID 56628718
(4-cyano-3,5-difluorophenyl) benzoate (PubChem CID 56628718) has the molecular formula C14H7F2NO2 and a molecular weight of 259.21 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) benzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) benzoate |
|---|---|
| PubChem CID | 56628718 |
| Molecular Formula | C14H7F2NO2 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) benzoate |
| SMILES | N#Cc1c(F)cc(OC(=O)c2ccccc2)cc1F |
| InChI | InChI=1S/C14H7F2NO2/c15-12-6-10(7-13(16)11(12)8-17)19-14(18)9-4-2-1-3-5-9/h1-7H |
| InChIKey | ZJNNDDWLGWFHPE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|