C20H15F4NO2 — CID 70145832
(4-cyano-3,5-difluorophenyl) 4-[(E)-2,6-difluorohex-3-enyl]benzoate (PubChem CID 70145832) has the molecular formula C20H15F4NO2 and a molecular weight of 377.34 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-[(E)-2,6-difluorohex-3-enyl]benzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-[(E)-2,6-difluorohex-3-enyl]benzoate |
|---|---|
| PubChem CID | 70145832 |
| Molecular Formula | C20H15F4NO2 |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-[(E)-2,6-difluorohex-3-enyl]benzoate |
| SMILES | N#Cc1c(F)cc(OC(=O)c2ccc(CC(F)/C=C/CCF)cc2)cc1F |
| InChI | InChI=1S/C20H15F4NO2/c21-8-2-1-3-15(22)9-13-4-6-14(7-5-13)20(26)27-16-10-18(23)17(12-25)19(24)11-16/h1,3-7,10-11,15H,2,8-9H2/b3-1+ |
| InChIKey | GUAVCLYEHUNEDJ-HNQUOIGGSA-N |
| XLogP | 4.85 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|