C19H15F2NO2 — CID 59069860
(4-cyano-3,5-difluorophenyl) 4-[(Z)-pent-3-enyl]benzoate (PubChem CID 59069860) has the molecular formula C19H15F2NO2 and a molecular weight of 327.33 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 4-[(Z)-pent-3-enyl]benzoate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 4-[(Z)-pent-3-enyl]benzoate |
|---|---|
| PubChem CID | 59069860 |
| Molecular Formula | C19H15F2NO2 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 4-[(Z)-pent-3-enyl]benzoate |
| SMILES | C/C=C\CCc1ccc(C(=O)Oc2cc(F)c(C#N)c(F)c2)cc1 |
| InChI | InChI=1S/C19H15F2NO2/c1-2-3-4-5-13-6-8-14(9-7-13)19(23)24-15-10-17(20)16(12-22)18(21)11-15/h2-3,6-11H,4-5H2,1H3/b3-2- |
| InChIKey | SFOGYXZKRQHGCB-IHWYPQMZSA-N |
| XLogP | 4.56 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|