C33H30F2O2 — CID 58699227
[4-[(E)-pent-3-enyl]phenyl] 4-[3,5-difluoro-4-[(2R)-2-phenylpropyl]phenyl]benzoate (PubChem CID 58699227) has the molecular formula C33H30F2O2 and a molecular weight of 496.60 g/mol. Its IUPAC name is [4-[(E)-pent-3-enyl]phenyl] 4-[3,5-difluoro-4-[(2R)-2-phenylpropyl]phenyl]benzoate.
| Compound Name | [4-[(E)-pent-3-enyl]phenyl] 4-[3,5-difluoro-4-[(2R)-2-phenylpropyl]phenyl]benzoate |
|---|---|
| PubChem CID | 58699227 |
| Molecular Formula | C33H30F2O2 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | [4-[(E)-pent-3-enyl]phenyl] 4-[3,5-difluoro-4-[(2R)-2-phenylpropyl]phenyl]benzoate |
| SMILES | C/C=C/CCc1ccc(OC(=O)c2ccc(-c3cc(F)c(C[C@@H](C)c4ccccc4)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C33H30F2O2/c1-3-4-6-9-24-12-18-29(19-13-24)37-33(36)27-16-14-26(15-17-27)28-21-31(34)30(32(35)22-28)20-23(2)25-10-7-5-8-11-25/h3-5,7-8,10-19,21-23H,6,9,20H2,1-2H3/b4-3+/t23-/m1/s1 |
| InChIKey | FUKOKSZXYMPUOH-OSFWOZTASA-N |
| XLogP | 8.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|