C35H33FO2 — CID 58698141
[4-[(E)-pent-3-enyl]phenyl] 4-[2-[2-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzoate (PubChem CID 58698141) has the molecular formula C35H33FO2 and a molecular weight of 504.65 g/mol. Its IUPAC name is [4-[(E)-pent-3-enyl]phenyl] 4-[2-[2-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzoate.
| Compound Name | [4-[(E)-pent-3-enyl]phenyl] 4-[2-[2-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 58698141 |
| Molecular Formula | C35H33FO2 |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [4-[(E)-pent-3-enyl]phenyl] 4-[2-[2-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzoate |
| SMILES | C/C=C/CCc1ccc(OC(=O)c2ccc(C=Cc3ccc(C[C@@H](C)c4ccccc4)cc3F)cc2)cc1 |
| InChI | InChI=1S/C35H33FO2/c1-3-4-6-9-27-16-22-33(23-17-27)38-35(37)32-20-13-28(14-21-32)12-18-31-19-15-29(25-34(31)36)24-26(2)30-10-7-5-8-11-30/h3-5,7-8,10-23,25-26H,6,9,24H2,1-2H3/b4-3+,18-12?/t26-/m1/s1 |
| InChIKey | OPBPKUKHHUIBLY-WTXVXQKJSA-N |
| XLogP | 9.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|