C37H28FNO2 — CID 58698542
(4-cyanophenyl) 4-[2-[2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]phenyl]ethenyl]benzoate (PubChem CID 58698542) has the molecular formula C37H28FNO2 and a molecular weight of 537.63 g/mol. Its IUPAC name is (4-cyanophenyl) 4-[2-[2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]phenyl]ethenyl]benzoate.
| Compound Name | (4-cyanophenyl) 4-[2-[2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 58698542 |
| Molecular Formula | C37H28FNO2 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | (4-cyanophenyl) 4-[2-[2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]phenyl]ethenyl]benzoate |
| SMILES | C[C@H](Cc1ccc(-c2ccc(C=Cc3ccc(C(=O)Oc4ccc(C#N)cc4)cc3)c(F)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C37H28FNO2/c1-26(30-5-3-2-4-6-30)23-28-10-14-31(15-11-28)34-20-19-32(36(38)24-34)16-7-27-8-17-33(18-9-27)37(40)41-35-21-12-29(25-39)13-22-35/h2-22,24,26H,23H2,1H3/t26-/m1/s1 |
| InChIKey | NNHNQIDRRUFSHL-AREMUKBSSA-N |
| XLogP | 9.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|