C38H35F — CID 58698086
2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene (PubChem CID 58698086) has the molecular formula C38H35F and a molecular weight of 510.70 g/mol. Its IUPAC name is 2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene.
| Compound Name | 2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698086 |
| Molecular Formula | C38H35F |
| Molecular Weight | 510.70 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | 2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylphenyl)phenyl]ethenyl]benzene |
| SMILES | CCCc1ccc(-c2ccc(C=Cc3ccc(-c4ccc(C[C@@H](C)c5ccccc5)cc4)cc3F)cc2)cc1 |
| InChI | InChI=1S/C38H35F/c1-3-7-29-10-17-33(18-11-29)34-19-12-30(13-20-34)14-23-36-24-25-37(27-38(36)39)35-21-15-31(16-22-35)26-28(2)32-8-5-4-6-9-32/h4-6,8-25,27-28H,3,7,26H2,1-2H3/t28-/m1/s1 |
| InChIKey | QLQDDQCYKKRBTM-MUUNZHRXSA-N |
| XLogP | 10.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.70 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|