C38H32FN — CID 58699390
4-[2-[3-fluoro-4-[2-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]ethenyl]phenyl]ethyl]benzonitrile (PubChem CID 58699390) has the molecular formula C38H32FN and a molecular weight of 521.68 g/mol. Its IUPAC name is 4-[2-[3-fluoro-4-[2-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]ethenyl]phenyl]ethyl]benzonitrile.
| Compound Name | 4-[2-[3-fluoro-4-[2-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]ethenyl]phenyl]ethyl]benzonitrile |
|---|---|
| PubChem CID | 58699390 |
| Molecular Formula | C38H32FN |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 4-[2-[3-fluoro-4-[2-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]ethenyl]phenyl]ethyl]benzonitrile |
| SMILES | C[C@@H](Cc1ccc(-c2ccc(C=Cc3ccc(CCc4ccc(C#N)cc4)cc3F)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C38H32FN/c1-28(34-5-3-2-4-6-34)25-31-16-21-36(22-17-31)35-19-13-30(14-20-35)15-23-37-24-18-32(26-38(37)39)10-7-29-8-11-33(27-40)12-9-29/h2-6,8-9,11-24,26,28H,7,10,25H2,1H3/t28-/m0/s1 |
| InChIKey | LFQPXNFGFLVDML-NDEPHWFRSA-N |
| XLogP | 9.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|