C30H25N — CID 58698926
4-[4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]phenyl]benzonitrile (PubChem CID 58698926) has the molecular formula C30H25N and a molecular weight of 399.54 g/mol. Its IUPAC name is 4-[4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 58698926 |
| Molecular Formula | C30H25N |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 4-[4-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]phenyl]benzonitrile |
| SMILES | C[C@H](Cc1ccc(C=Cc2ccc(-c3ccc(C#N)cc3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H25N/c1-23(28-5-3-2-4-6-28)21-26-11-9-24(10-12-26)7-8-25-13-17-29(18-14-25)30-19-15-27(22-31)16-20-30/h2-20,23H,21H2,1H3/t23-/m1/s1 |
| InChIKey | KACYYLMWDPVBKX-HSZRJFAPSA-N |
| XLogP | 7.74 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|