C23H20F2 — CID 58698775
2-fluoro-1-[2-(4-fluorophenyl)ethenyl]-4-[(2R)-2-phenylpropyl]benzene (PubChem CID 58698775) has the molecular formula C23H20F2 and a molecular weight of 334.41 g/mol. Its IUPAC name is 2-fluoro-1-[2-(4-fluorophenyl)ethenyl]-4-[(2R)-2-phenylpropyl]benzene.
| Compound Name | 2-fluoro-1-[2-(4-fluorophenyl)ethenyl]-4-[(2R)-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 58698775 |
| Molecular Formula | C23H20F2 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-fluoro-1-[2-(4-fluorophenyl)ethenyl]-4-[(2R)-2-phenylpropyl]benzene |
| SMILES | C[C@H](Cc1ccc(C=Cc2ccc(F)cc2)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C23H20F2/c1-17(20-5-3-2-4-6-20)15-19-8-12-21(23(25)16-19)11-7-18-9-13-22(24)14-10-18/h2-14,16-17H,15H2,1H3/t17-/m1/s1 |
| InChIKey | VAUDBMPYMAJGRT-QGZVFWFLSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|