C23H19F3 — CID 58698107
2,4-difluoro-1-[2-[3-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene (PubChem CID 58698107) has the molecular formula C23H19F3 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2,4-difluoro-1-[2-[3-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene.
| Compound Name | 2,4-difluoro-1-[2-[3-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698107 |
| Molecular Formula | C23H19F3 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2,4-difluoro-1-[2-[3-fluoro-4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
| SMILES | C[C@H](Cc1ccc(C=Cc2ccc(F)cc2F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C23H19F3/c1-16(18-5-3-2-4-6-18)13-20-10-8-17(14-22(20)25)7-9-19-11-12-21(24)15-23(19)26/h2-12,14-16H,13H2,1H3/t16-/m1/s1 |
| InChIKey | AEVJSNQHRDDEJY-MRXNPFEDSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|