C36H37F — CID 58699470
2-fluoro-1-[2-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethenyl]-4-[(2R)-2-phenylpropyl]benzene (PubChem CID 58699470) has the molecular formula C36H37F and a molecular weight of 488.69 g/mol. Its IUPAC name is 2-fluoro-1-[2-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethenyl]-4-[(2R)-2-phenylpropyl]benzene.
| Compound Name | 2-fluoro-1-[2-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethenyl]-4-[(2R)-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 58699470 |
| Molecular Formula | C36H37F |
| Molecular Weight | 488.69 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 2-fluoro-1-[2-[4-[2-[4-[(E)-pent-3-enyl]phenyl]ethyl]phenyl]ethenyl]-4-[(2R)-2-phenylpropyl]benzene |
| SMILES | C/C=C/CCc1ccc(CCc2ccc(C=Cc3ccc(C[C@@H](C)c4ccccc4)cc3F)cc2)cc1 |
| InChI | InChI=1S/C36H37F/c1-3-4-6-9-29-12-14-30(15-13-29)16-17-31-18-20-32(21-19-31)22-24-35-25-23-33(27-36(35)37)26-28(2)34-10-7-5-8-11-34/h3-5,7-8,10-15,18-25,27-28H,6,9,16-17,26H2,1-2H3/b4-3+,24-22?/t28-/m1/s1 |
| InChIKey | WTEWYAUQTIGLLG-STMVFDMDSA-N |
| XLogP | 9.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.69 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|