C28H28F2 — CID 91003590
1,3-difluoro-5-pent-3-enyl-2-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene (PubChem CID 91003590) has the molecular formula C28H28F2 and a molecular weight of 402.53 g/mol. Its IUPAC name is 1,3-difluoro-5-pent-3-enyl-2-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene.
| Compound Name | 1,3-difluoro-5-pent-3-enyl-2-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 91003590 |
| Molecular Formula | C28H28F2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1,3-difluoro-5-pent-3-enyl-2-[2-[4-[(2R)-2-phenylpropyl]phenyl]ethenyl]benzene |
| SMILES | CC=CCCc1cc(F)c(C=Cc2ccc(C[C@@H](C)c3ccccc3)cc2)c(F)c1 |
| InChI | InChI=1S/C28H28F2/c1-3-4-6-9-24-19-27(29)26(28(30)20-24)17-16-22-12-14-23(15-13-22)18-21(2)25-10-7-5-8-11-25/h3-5,7-8,10-17,19-21H,6,9,18H2,1-2H3/t21-/m1/s1 |
| InChIKey | BJWCBVBJMQVLCF-OAQYLSRUSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|