C28H28F2 — CID 58698929
2-fluoro-1-[2-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene (PubChem CID 58698929) has the molecular formula C28H28F2 and a molecular weight of 402.53 g/mol. Its IUPAC name is 2-fluoro-1-[2-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene.
| Compound Name | 2-fluoro-1-[2-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 58698929 |
| Molecular Formula | C28H28F2 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 2-fluoro-1-[2-[3-fluoro-4-[(E)-pent-3-enyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene |
| SMILES | C/C=C/CCc1ccc(C=Cc2ccc(C[C@H](C)c3ccccc3)cc2F)cc1F |
| InChI | InChI=1S/C28H28F2/c1-3-4-6-11-25-15-12-22(19-27(25)29)13-16-26-17-14-23(20-28(26)30)18-21(2)24-9-7-5-8-10-24/h3-5,7-10,12-17,19-21H,6,11,18H2,1-2H3/b4-3+,16-13?/t21-/m0/s1 |
| InChIKey | DWYPDHTYMIKTFH-OQACSUQJSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|