C32H30F2 — CID 91167302
1,3-difluoro-2-pent-3-enyl-5-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]benzene (PubChem CID 91167302) has the molecular formula C32H30F2 and a molecular weight of 452.59 g/mol. Its IUPAC name is 1,3-difluoro-2-pent-3-enyl-5-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]benzene.
| Compound Name | 1,3-difluoro-2-pent-3-enyl-5-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 91167302 |
| Molecular Formula | C32H30F2 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1,3-difluoro-2-pent-3-enyl-5-[4-[4-[(2S)-2-phenylpropyl]phenyl]phenyl]benzene |
| SMILES | CC=CCCc1c(F)cc(-c2ccc(-c3ccc(C[C@H](C)c4ccccc4)cc3)cc2)cc1F |
| InChI | InChI=1S/C32H30F2/c1-3-4-6-11-30-31(33)21-29(22-32(30)34)28-18-16-27(17-19-28)26-14-12-24(13-15-26)20-23(2)25-9-7-5-8-10-25/h3-5,7-10,12-19,21-23H,6,11,20H2,1-2H3/t23-/m0/s1 |
| InChIKey | YFUQFIBHZLGMGK-QHCPKHFHSA-N |
| XLogP | 9.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|