C38H41F — CID 58698876
2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylcyclohexyl)phenyl]ethenyl]benzene (PubChem CID 58698876) has the molecular formula C38H41F and a molecular weight of 516.74 g/mol. Its IUPAC name is 2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylcyclohexyl)phenyl]ethenyl]benzene.
| Compound Name | 2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylcyclohexyl)phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 58698876 |
| Molecular Formula | C38H41F |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | 2-fluoro-4-[4-[(2R)-2-phenylpropyl]phenyl]-1-[2-[4-(4-propylcyclohexyl)phenyl]ethenyl]benzene |
| SMILES | CCCC1CCC(c2ccc(C=Cc3ccc(-c4ccc(C[C@@H](C)c5ccccc5)cc4)cc3F)cc2)CC1 |
| InChI | InChI=1S/C38H41F/c1-3-7-29-10-17-33(18-11-29)34-19-12-30(13-20-34)14-23-36-24-25-37(27-38(36)39)35-21-15-31(16-22-35)26-28(2)32-8-5-4-6-9-32/h4-6,8-9,12-16,19-25,27-29,33H,3,7,10-11,17-18,26H2,1-2H3/t28-,29?,33?/m1/s1 |
| InChIKey | FREMYBDSAXVVCE-OBYBKVPASA-N |
| XLogP | 11.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|