C34H39F — CID 58699346
2-fluoro-1-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene (PubChem CID 58699346) has the molecular formula C34H39F and a molecular weight of 466.68 g/mol. Its IUPAC name is 2-fluoro-1-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene.
| Compound Name | 2-fluoro-1-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene |
|---|---|
| PubChem CID | 58699346 |
| Molecular Formula | C34H39F |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | 2-fluoro-1-[2-[4-[4-[(E)-pent-3-enyl]cyclohexyl]phenyl]ethenyl]-4-[(2S)-2-phenylpropyl]benzene |
| SMILES | C/C=C/CCC1CCC(c2ccc(C=Cc3ccc(C[C@H](C)c4ccccc4)cc3F)cc2)CC1 |
| InChI | InChI=1S/C34H39F/c1-3-4-6-9-27-12-18-31(19-13-27)32-20-14-28(15-21-32)16-22-33-23-17-29(25-34(33)35)24-26(2)30-10-7-5-8-11-30/h3-5,7-8,10-11,14-17,20-23,25-27,31H,6,9,12-13,18-19,24H2,1-2H3/b4-3+,22-16?/t26-,27?,31?/m0/s1 |
| InChIKey | WACGYPVIMCFRCZ-BTIBURRYSA-N |
| XLogP | 9.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|