C28H21ClF2O2 — CID 21052980
(4-chloro-3,5-difluorophenyl) 4-[4-(2-phenylpropyl)phenyl]benzoate (PubChem CID 21052980) has the molecular formula C28H21ClF2O2 and a molecular weight of 462.92 g/mol. Its IUPAC name is (4-chloro-3,5-difluorophenyl) 4-[4-(2-phenylpropyl)phenyl]benzoate.
| Compound Name | (4-chloro-3,5-difluorophenyl) 4-[4-(2-phenylpropyl)phenyl]benzoate |
|---|---|
| PubChem CID | 21052980 |
| Molecular Formula | C28H21ClF2O2 |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (4-chloro-3,5-difluorophenyl) 4-[4-(2-phenylpropyl)phenyl]benzoate |
| SMILES | CC(Cc1ccc(-c2ccc(C(=O)Oc3cc(F)c(Cl)c(F)c3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H21ClF2O2/c1-18(20-5-3-2-4-6-20)15-19-7-9-21(10-8-19)22-11-13-23(14-12-22)28(32)33-24-16-25(30)27(29)26(31)17-24/h2-14,16-18H,15H2,1H3 |
| InChIKey | NYDVTJUMOLEOJF-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|