C31H24FNO2 — CID 58698801
(4-cyano-3-fluorophenyl) 4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethenyl]benzoate (PubChem CID 58698801) has the molecular formula C31H24FNO2 and a molecular weight of 461.54 g/mol. Its IUPAC name is (4-cyano-3-fluorophenyl) 4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethenyl]benzoate.
| Compound Name | (4-cyano-3-fluorophenyl) 4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 58698801 |
| Molecular Formula | C31H24FNO2 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (4-cyano-3-fluorophenyl) 4-[2-[4-[(2S)-2-phenylpropyl]phenyl]ethenyl]benzoate |
| SMILES | C[C@@H](Cc1ccc(C=Cc2ccc(C(=O)Oc3ccc(C#N)c(F)c3)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H24FNO2/c1-22(26-5-3-2-4-6-26)19-25-11-9-23(10-12-25)7-8-24-13-15-27(16-14-24)31(34)35-29-18-17-28(21-33)30(32)20-29/h2-18,20,22H,19H2,1H3/t22-/m0/s1 |
| InChIKey | YJPOHVQNORDYPM-QFIPXVFZSA-N |
| XLogP | 7.43 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|