C14H7F2NO2S — CID 91483040
(4-cyano-3,5-difluorophenyl) 5-ethenylthiophene-2-carboxylate (PubChem CID 91483040) has the molecular formula C14H7F2NO2S and a molecular weight of 291.28 g/mol. Its IUPAC name is (4-cyano-3,5-difluorophenyl) 5-ethenylthiophene-2-carboxylate.
| Compound Name | (4-cyano-3,5-difluorophenyl) 5-ethenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 91483040 |
| Molecular Formula | C14H7F2NO2S |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (4-cyano-3,5-difluorophenyl) 5-ethenylthiophene-2-carboxylate |
| SMILES | C=Cc1ccc(C(=O)Oc2cc(F)c(C#N)c(F)c2)s1 |
| InChI | InChI=1S/C14H7F2NO2S/c1-2-9-3-4-13(20-9)14(18)19-8-5-11(15)10(7-17)12(16)6-8/h2-6H,1H2 |
| InChIKey | HSGJPMZHARKYDG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|