C16H12F2O4 — CID 17409562
(2-acetyl-5-methoxyphenyl) 2,4-difluorobenzoate (PubChem CID 17409562) has the molecular formula C16H12F2O4 and a molecular weight of 306.26 g/mol. Its IUPAC name is (2-acetyl-5-methoxyphenyl) 2,4-difluorobenzoate.
| Compound Name | (2-acetyl-5-methoxyphenyl) 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 17409562 |
| Molecular Formula | C16H12F2O4 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2-acetyl-5-methoxyphenyl) 2,4-difluorobenzoate |
| SMILES | COc1ccc(C(C)=O)c(OC(=O)c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H12F2O4/c1-9(19)12-6-4-11(21-2)8-15(12)22-16(20)13-5-3-10(17)7-14(13)18/h3-8H,1-2H3 |
| InChIKey | JITJYXVKCOHDED-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|