C16H14F3NO5 — CID 90828965
(3,5-difluoro-4-nitrophenyl) 2-fluoro-4-methoxybenzoate;ethane (PubChem CID 90828965) has the molecular formula C16H14F3NO5 and a molecular weight of 357.28 g/mol. Its IUPAC name is (3,5-difluoro-4-nitrophenyl) 2-fluoro-4-methoxybenzoate;ethane.
| Compound Name | (3,5-difluoro-4-nitrophenyl) 2-fluoro-4-methoxybenzoate;ethane |
|---|---|
| PubChem CID | 90828965 |
| Molecular Formula | C16H14F3NO5 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (3,5-difluoro-4-nitrophenyl) 2-fluoro-4-methoxybenzoate;ethane |
| SMILES | CC.COc1ccc(C(=O)Oc2cc(F)c([N+](=O)[O-])c(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H8F3NO5.C2H6/c1-22-7-2-3-9(10(15)4-7)14(19)23-8-5-11(16)13(18(20)21)12(17)6-8;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | BZWYETRUKKWPQP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|