C28H17F3N2O2 — CID 58029033
(Z)-3-[5-[5-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]furan-2-yl]furan-2-yl]-2-(4-methylphenyl)prop-2-enenitrile (PubChem CID 58029033) has the molecular formula C28H17F3N2O2 and a molecular weight of 470.45 g/mol. Its IUPAC name is (Z)-3-[5-[5-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]furan-2-yl]furan-2-yl]-2-(4-methylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[5-[5-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]furan-2-yl]furan-2-yl]-2-(4-methylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 58029033 |
| Molecular Formula | C28H17F3N2O2 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (Z)-3-[5-[5-[(Z)-2-isocyano-2-[4-(trifluoromethyl)phenyl]ethenyl]furan-2-yl]furan-2-yl]-2-(4-methylphenyl)prop-2-enenitrile |
| SMILES | [C-]#[N+]/C(=C\c1ccc(-c2ccc(/C=C(\C#N)c3ccc(C)cc3)o2)o1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H17F3N2O2/c1-18-3-5-19(6-4-18)21(17-32)15-23-11-13-26(34-23)27-14-12-24(35-27)16-25(33-2)20-7-9-22(10-8-20)28(29,30)31/h3-16H,1H3/b21-15+,25-16- |
| InChIKey | KBDGXKBMOXLDKW-FCCHBDCFSA-N |
| XLogP | 8.35 |
| TPSA | 54.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|