C22H29BN2O3 — CID 67565770
diazanium;dioxido(4,4,4-triphenylbutoxy)borane (PubChem CID 67565770) has the molecular formula C22H29BN2O3 and a molecular weight of 380.30 g/mol. Its IUPAC name is diazanium;dioxido(4,4,4-triphenylbutoxy)borane.
| Compound Name | diazanium;dioxido(4,4,4-triphenylbutoxy)borane |
|---|---|
| PubChem CID | 67565770 |
| Molecular Formula | C22H29BN2O3 |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | diazanium;dioxido(4,4,4-triphenylbutoxy)borane |
| SMILES | [NH4+].[NH4+].[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2H3N/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;;/h1-9,11-16H,10,17-18H2;2*1H3/q-2;;/p+2 |
| InChIKey | AQAJRIMGMRFYTA-UHFFFAOYSA-P |
| XLogP | 3.28 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|