C54H61BN2O7 — CID 139778201
dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-(4-propan-2-ylphenoxy)pyridin-1-ium) (PubChem CID 139778201) has the molecular formula C54H61BN2O7 and a molecular weight of 860.90 g/mol. Its IUPAC name is dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-(4-propan-2-ylphenoxy)pyridin-1-ium).
| Compound Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-(4-propan-2-ylphenoxy)pyridin-1-ium) |
|---|---|
| PubChem CID | 139778201 |
| Molecular Formula | C54H61BN2O7 |
| Molecular Weight | 860.90 g/mol |
| Exact Mass | 860.46 |
| IUPAC Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-(4-propan-2-ylphenoxy)pyridin-1-ium) |
| SMILES | CCO[n+]1ccccc1Oc1ccc(C(C)C)cc1.CCO[n+]1ccccc1Oc1ccc(C(C)C)cc1.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2C16H20NO2/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-4-18-17-12-6-5-7-16(17)19-15-10-8-14(9-11-15)13(2)3/h1-9,11-16H,10,17-18H2;2*5-13H,4H2,1-3H3/q-2;2*+1 |
| InChIKey | LZKQXANZVVLGKT-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.90 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|