C62H57BN2O9 — CID 139778006
dioxido(4,4,4-triphenylbutoxy)borane;bis((4-phenylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate) (PubChem CID 139778006) has the molecular formula C62H57BN2O9 and a molecular weight of 984.95 g/mol. Its IUPAC name is dioxido(4,4,4-triphenylbutoxy)borane;bis((4-phenylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate).
| Compound Name | dioxido(4,4,4-triphenylbutoxy)borane;bis((4-phenylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate) |
|---|---|
| PubChem CID | 139778006 |
| Molecular Formula | C62H57BN2O9 |
| Molecular Weight | 984.95 g/mol |
| Exact Mass | 984.42 |
| IUPAC Name | dioxido(4,4,4-triphenylbutoxy)borane;bis((4-phenylphenyl) 1-ethoxypyridin-1-ium-2-carboxylate) |
| SMILES | CCO[n+]1ccccc1C(=O)Oc1ccc(-c2ccccc2)cc1.CCO[n+]1ccccc1C(=O)Oc1ccc(-c2ccccc2)cc1.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2C20H18NO3/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-2-23-21-15-7-6-10-19(21)20(22)24-18-13-11-17(12-14-18)16-8-4-3-5-9-16/h1-9,11-16H,10,17-18H2;2*3-15H,2H2,1H3/q-2;2*+1 |
| InChIKey | QFWBPTMCKWRSPO-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.95 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|