C12H18NO2+ — CID 139777999
1-(1-ethoxypyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 139777999) has the molecular formula C12H18NO2+ and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-(1-ethoxypyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(1-ethoxypyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 139777999 |
| Molecular Formula | C12H18NO2+ |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-(1-ethoxypyridin-1-ium-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | CCO[n+]1ccccc1C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H18NO2/c1-5-15-13-9-7-6-8-10(13)11(14)12(2,3)4/h6-9H,5H2,1-4H3/q+1 |
| InChIKey | PNCCRCRGGRITRM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|