About phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate
phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate (PubChem CID 139778056) has the molecular formula C22H18NO3+
and a molecular weight of 344.39 g/mol. Its IUPAC name is phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate.
Molecular Properties
| Compound Name | phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate |
| PubChem CID | 139778056 |
| Molecular Formula | C22H18NO3+ |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate |
| SMILES | CCO[n+]1ccccc1C(=O)Oc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C22H18NO3/c1-2-25-23-14-8-7-13-20(23)22(24)26-21-15-16-9-3-4-10-17(16)18-11-5-6-12-19(18)21/h3-15H,2H2,1H3/q+1 |
| InChIKey | KSKFVOIHGXJXNQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate?
The IUPAC name of phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate (CID 139778056) is phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate.
What is the SMILES notation for phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate?
The canonical SMILES for phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate is CCO[n+]1ccccc1C(=O)Oc1cc2ccccc2c2ccccc12.
What is the InChIKey of phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate?
The InChIKey is KSKFVOIHGXJXNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18NO3/c1-2-25-23-14-8-7-13-20(23)22(24)26-21-15-16-9-3-4-10-17(16)18-11-5-6-12-19(18)21/h3-15H,2H2,1H3/q+1.
What are the key properties of phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate?
phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate has a molecular weight of 344.39 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthren-9-yl 1-ethoxypyridin-1-ium-2-carboxylate is sourced from PubChem (CID 139778056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).