C25H34O2 — CID 164954844
anthracene;ethane;ethyl 2,2,3-trimethylbutanoate (PubChem CID 164954844) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is anthracene;ethane;ethyl 2,2,3-trimethylbutanoate.
| Compound Name | anthracene;ethane;ethyl 2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 164954844 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | anthracene;ethane;ethyl 2,2,3-trimethylbutanoate |
| SMILES | CC.CCOC(=O)C(C)(C)C(C)C.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C9H18O2.C2H6/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-6-11-8(10)9(4,5)7(2)3;1-2/h1-10H;7H,6H2,1-5H3;1-2H3 |
| InChIKey | BAPQESVURRZKKP-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|