C26H30BClO4 — CID 158585281
CID 158585281 (PubChem CID 158585281) has the molecular formula C26H30BClO4 and a molecular weight of 452.79 g/mol.
| Compound Name | CID 158585281 |
|---|---|
| PubChem CID | 158585281 |
| Molecular Formula | C26H30BClO4 |
| Molecular Weight | 452.79 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | — |
| SMILES | CCCC(=O)[ClH2+2].[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.C4H9ClO/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;1-2-3-4(5)6/h1-9,11-16H,10,17-18H2;2-3,5H2,1H3/q-2;+2 |
| InChIKey | YKLVXIYXPQJYTM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|