C56H53BN2O5 — CID 139778207
dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-naphthalen-1-ylpyridin-1-ium) (PubChem CID 139778207) has the molecular formula C56H53BN2O5 and a molecular weight of 844.86 g/mol. Its IUPAC name is dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-naphthalen-1-ylpyridin-1-ium).
| Compound Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-naphthalen-1-ylpyridin-1-ium) |
|---|---|
| PubChem CID | 139778207 |
| Molecular Formula | C56H53BN2O5 |
| Molecular Weight | 844.86 g/mol |
| Exact Mass | 844.40 |
| IUPAC Name | dioxido(4,4,4-triphenylbutoxy)borane;bis(1-ethoxy-2-naphthalen-1-ylpyridin-1-ium) |
| SMILES | CCO[n+]1ccccc1-c1cccc2ccccc12.CCO[n+]1ccccc1-c1cccc2ccccc12.[O-]B([O-])OCCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO3.2C17H16NO/c24-23(25)26-18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-2-19-18-13-6-5-12-17(18)16-11-7-9-14-8-3-4-10-15(14)16/h1-9,11-16H,10,17-18H2;2*3-13H,2H2,1H3/q-2;2*+1 |
| InChIKey | UVGGDLJNBQQHBA-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 81.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.86 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|