C38H61BN2O2 — CID 156778480
dioxido(4,4,4-triphenylbutyl)borane;bis(tetraethylazanium) (PubChem CID 156778480) has the molecular formula C38H61BN2O2 and a molecular weight of 588.73 g/mol. Its IUPAC name is dioxido(4,4,4-triphenylbutyl)borane;bis(tetraethylazanium).
| Compound Name | dioxido(4,4,4-triphenylbutyl)borane;bis(tetraethylazanium) |
|---|---|
| PubChem CID | 156778480 |
| Molecular Formula | C38H61BN2O2 |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.48 |
| IUPAC Name | dioxido(4,4,4-triphenylbutyl)borane;bis(tetraethylazanium) |
| SMILES | CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.[O-]B([O-])CCCC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H21BO2.2C8H20N/c24-23(25)18-10-17-22(19-11-4-1-5-12-19,20-13-6-2-7-14-20)21-15-8-3-9-16-21;2*1-5-9(6-2,7-3)8-4/h1-9,11-16H,10,17-18H2;2*5-8H2,1-4H3/q-2;2*+1 |
| InChIKey | HNSATQVCZMOECE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|