About dioxido(phenyl)borane;bis(tetraethylazanium)
dioxido(phenyl)borane;bis(tetraethylazanium) (PubChem CID 141151570) has the molecular formula C22H45BN2O2
and a molecular weight of 380.43 g/mol. Its IUPAC name is dioxido(phenyl)borane;bis(tetraethylazanium).
Molecular Properties
| Compound Name | dioxido(phenyl)borane;bis(tetraethylazanium) |
| PubChem CID | 141151570 |
| Molecular Formula | C22H45BN2O2 |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.36 |
| IUPAC Name | dioxido(phenyl)borane;bis(tetraethylazanium) |
| SMILES | CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.[O-]B([O-])c1ccccc1 |
| InChI | InChI=1S/2C8H20N.C6H5BO2/c2*1-5-9(6-2,7-3)8-4;8-7(9)6-4-2-1-3-5-6/h2*5-8H2,1-4H3;1-5H/q2*+1;-2 |
| InChIKey | CYCUWOAACAZFCN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dioxido(phenyl)borane;bis(tetraethylazanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxido(phenyl)borane;bis(tetraethylazanium)?
The IUPAC name of dioxido(phenyl)borane;bis(tetraethylazanium) (CID 141151570) is dioxido(phenyl)borane;bis(tetraethylazanium).
What is the SMILES notation for dioxido(phenyl)borane;bis(tetraethylazanium)?
The canonical SMILES for dioxido(phenyl)borane;bis(tetraethylazanium) is CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC.[O-]B([O-])c1ccccc1.
What is the InChIKey of dioxido(phenyl)borane;bis(tetraethylazanium)?
The InChIKey is CYCUWOAACAZFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H20N.C6H5BO2/c2*1-5-9(6-2,7-3)8-4;8-7(9)6-4-2-1-3-5-6/h2*5-8H2,1-4H3;1-5H/q2*+1;-2.
What are the key properties of dioxido(phenyl)borane;bis(tetraethylazanium)?
dioxido(phenyl)borane;bis(tetraethylazanium) has a molecular weight of 380.43 g/mol, XLogP of 1.87, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dioxido(phenyl)borane;bis(tetraethylazanium) is sourced from PubChem (CID 141151570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).