About bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane
bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane (PubChem CID 141011580) has the molecular formula C22H29BN2O2
and a molecular weight of 364.30 g/mol. Its IUPAC name is bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane.
Molecular Properties
| Compound Name | bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane |
| PubChem CID | 141011580 |
| Molecular Formula | C22H29BN2O2 |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane |
| SMILES | C[NH+](C)c1ccccc1.C[NH+](C)c1ccccc1.[O-]B([O-])c1ccccc1 |
| InChI | InChI=1S/2C8H11N.C6H5BO2/c2*1-9(2)8-6-4-3-5-7-8;8-7(9)6-4-2-1-3-5-6/h2*3-7H,1-2H3;1-5H/q;;-2/p+2 |
| InChIKey | BNYXZKJURVPROU-UHFFFAOYSA-P |
| XLogP | -0.97 |
| TPSA | 55.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane?
The IUPAC name of bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane (CID 141011580) is bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane.
What is the SMILES notation for bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane?
The canonical SMILES for bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane is C[NH+](C)c1ccccc1.C[NH+](C)c1ccccc1.[O-]B([O-])c1ccccc1.
What is the InChIKey of bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane?
The InChIKey is BNYXZKJURVPROU-UHFFFAOYSA-P. The full InChI is InChI=1S/2C8H11N.C6H5BO2/c2*1-9(2)8-6-4-3-5-7-8;8-7(9)6-4-2-1-3-5-6/h2*3-7H,1-2H3;1-5H/q;;-2/p+2.
What are the key properties of bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane?
bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane has a molecular weight of 364.30 g/mol, XLogP of -0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dimethyl(phenyl)azanium);dioxido(phenyl)borane is sourced from PubChem (CID 141011580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).