C38H61BN2O3 — CID 67933329
dioxido(1,1,2-triphenylbutoxy)borane;bis(tetraethylazanium) (PubChem CID 67933329) has the molecular formula C38H61BN2O3 and a molecular weight of 604.73 g/mol. Its IUPAC name is dioxido(1,1,2-triphenylbutoxy)borane;bis(tetraethylazanium).
| Compound Name | dioxido(1,1,2-triphenylbutoxy)borane;bis(tetraethylazanium) |
|---|---|
| PubChem CID | 67933329 |
| Molecular Formula | C38H61BN2O3 |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 604.48 |
| IUPAC Name | dioxido(1,1,2-triphenylbutoxy)borane;bis(tetraethylazanium) |
| SMILES | CCC(c1ccccc1)C(OB([O-])[O-])(c1ccccc1)c1ccccc1.CC[N+](CC)(CC)CC.CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C22H21BO3.2C8H20N/c1-2-21(18-12-6-3-7-13-18)22(26-23(24)25,19-14-8-4-9-15-19)20-16-10-5-11-17-20;2*1-5-9(6-2,7-3)8-4/h3-17,21H,2H2,1H3;2*5-8H2,1-4H3/q-2;2*+1 |
| InChIKey | YBBITOCBTINSHR-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|