C31H43BNO6- — CID 18696324
dioxido-[1,1,2-tris(4-methoxyphenyl)hexoxy]borane;tetramethylazanium (PubChem CID 18696324) has the molecular formula C31H43BNO6- and a molecular weight of 536.50 g/mol. Its IUPAC name is dioxido-[1,1,2-tris(4-methoxyphenyl)hexoxy]borane;tetramethylazanium.
| Compound Name | dioxido-[1,1,2-tris(4-methoxyphenyl)hexoxy]borane;tetramethylazanium |
|---|---|
| PubChem CID | 18696324 |
| Molecular Formula | C31H43BNO6- |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.32 |
| IUPAC Name | dioxido-[1,1,2-tris(4-methoxyphenyl)hexoxy]borane;tetramethylazanium |
| SMILES | CCCCC(c1ccc(OC)cc1)C(OB([O-])[O-])(c1ccc(OC)cc1)c1ccc(OC)cc1.C[N+](C)(C)C |
| InChI | InChI=1S/C27H31BO6.C4H12N/c1-5-6-7-26(20-8-14-23(31-2)15-9-20)27(34-28(29)30,21-10-16-24(32-3)17-11-21)22-12-18-25(33-4)19-13-22;1-5(2,3)4/h8-19,26H,5-7H2,1-4H3;1-4H3/q-2;+1 |
| InChIKey | SQTMIVPNCKYKRO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|