C75H81BO12 — CID 87849881
tris[1,1,2-tris(4-methoxyphenyl)butyl] borate (PubChem CID 87849881) has the molecular formula C75H81BO12 and a molecular weight of 1185.27 g/mol. Its IUPAC name is tris[1,1,2-tris(4-methoxyphenyl)butyl] borate.
| Compound Name | tris[1,1,2-tris(4-methoxyphenyl)butyl] borate |
|---|---|
| PubChem CID | 87849881 |
| Molecular Formula | C75H81BO12 |
| Molecular Weight | 1185.27 g/mol |
| Exact Mass | 1184.58 |
| IUPAC Name | tris[1,1,2-tris(4-methoxyphenyl)butyl] borate |
| SMILES | CCC(c1ccc(OC)cc1)C(OB(OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C(CC)c1ccc(OC)cc1)OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C(CC)c1ccc(OC)cc1)(c1ccc(OC)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C75H81BO12/c1-13-70(52-16-34-61(77-4)35-17-52)73(55-22-40-64(80-7)41-23-55,56-24-42-65(81-8)43-25-56)86-76(87-74(57-26-44-66(82-9)45-27-57,58-28-46-67(83-10)47-29-58)71(14-2)53-18-36-62(78-5)37-19-53)88-75(59-30-48-68(84-11)49-31-59,60-32-50-69(85-12)51-33-60)72(15-3)54-20-38-63(79-6)39-21-54/h16-51,70-72H,13-15H2,1-12H3 |
| InChIKey | IYEJEPOCCZOJLS-UHFFFAOYSA-N |
| XLogP | 16.51 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1185.27 |
| LogP ≤ 5 | 16.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|