C22H20BBr3O3 — CID 69257254
1,1,2-tris(3-bromophenyl)butoxyboronic acid (PubChem CID 69257254) has the molecular formula C22H20BBr3O3 and a molecular weight of 582.92 g/mol. Its IUPAC name is 1,1,2-tris(3-bromophenyl)butoxyboronic acid.
| Compound Name | 1,1,2-tris(3-bromophenyl)butoxyboronic acid |
|---|---|
| PubChem CID | 69257254 |
| Molecular Formula | C22H20BBr3O3 |
| Molecular Weight | 582.92 g/mol |
| Exact Mass | 579.91 |
| IUPAC Name | 1,1,2-tris(3-bromophenyl)butoxyboronic acid |
| SMILES | CCC(c1cccc(Br)c1)C(OB(O)O)(c1cccc(Br)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H20BBr3O3/c1-2-21(15-6-3-9-18(24)12-15)22(29-23(27)28,16-7-4-10-19(25)13-16)17-8-5-11-20(26)14-17/h3-14,21,27-28H,2H2,1H3 |
| InChIKey | PKDLMVKRNXJLMV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|