C13H20BrNO — CID 65187712
1-amino-2-(3-bromophenyl)-4-methylhexan-3-ol (PubChem CID 65187712) has the molecular formula C13H20BrNO and a molecular weight of 286.21 g/mol. Its IUPAC name is 1-amino-2-(3-bromophenyl)-4-methylhexan-3-ol.
| Compound Name | 1-amino-2-(3-bromophenyl)-4-methylhexan-3-ol |
|---|---|
| PubChem CID | 65187712 |
| Molecular Formula | C13H20BrNO |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-amino-2-(3-bromophenyl)-4-methylhexan-3-ol |
| SMILES | CCC(C)C(O)C(CN)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H20BrNO/c1-3-9(2)13(16)12(8-15)10-5-4-6-11(14)7-10/h4-7,9,12-13,16H,3,8,15H2,1-2H3 |
| InChIKey | VOUYTDHWCNABNA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |