C14H22BrNO — CID 65188289
1-amino-2-(3-bromophenyl)-5,5-dimethylhexan-3-ol (PubChem CID 65188289) has the molecular formula C14H22BrNO and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-amino-2-(3-bromophenyl)-5,5-dimethylhexan-3-ol.
| Compound Name | 1-amino-2-(3-bromophenyl)-5,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 65188289 |
| Molecular Formula | C14H22BrNO |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-amino-2-(3-bromophenyl)-5,5-dimethylhexan-3-ol |
| SMILES | CC(C)(C)CC(O)C(CN)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrNO/c1-14(2,3)8-13(17)12(9-16)10-5-4-6-11(15)7-10/h4-7,12-13,17H,8-9,16H2,1-3H3 |
| InChIKey | FZDAADSQZVCTFC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |