C24H26O3 — CID 20558061
1-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylbutan-1-ol (PubChem CID 20558061) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylbutan-1-ol.
| Compound Name | 1-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylbutan-1-ol |
|---|---|
| PubChem CID | 20558061 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-[4-(2-hydroxyethoxy)phenyl]-1,2-diphenylbutan-1-ol |
| SMILES | CCC(c1ccccc1)C(O)(c1ccccc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C24H26O3/c1-2-23(19-9-5-3-6-10-19)24(26,20-11-7-4-8-12-20)21-13-15-22(16-14-21)27-18-17-25/h3-16,23,25-26H,2,17-18H2,1H3 |
| InChIKey | WFFGIIBQUGBLSM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |