C28H34O4 — CID 139685238
2-[4-[2-ethyl-1-[4-(2-hydroxyethoxy)phenyl]-1-phenylbutyl]phenoxy]ethanol (PubChem CID 139685238) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[4-[2-ethyl-1-[4-(2-hydroxyethoxy)phenyl]-1-phenylbutyl]phenoxy]ethanol.
| Compound Name | 2-[4-[2-ethyl-1-[4-(2-hydroxyethoxy)phenyl]-1-phenylbutyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 139685238 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2-[4-[2-ethyl-1-[4-(2-hydroxyethoxy)phenyl]-1-phenylbutyl]phenoxy]ethanol |
| SMILES | CCC(CC)C(c1ccccc1)(c1ccc(OCCO)cc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C28H34O4/c1-3-22(4-2)28(23-8-6-5-7-9-23,24-10-14-26(15-11-24)31-20-18-29)25-12-16-27(17-13-25)32-21-19-30/h5-17,22,29-30H,3-4,18-21H2,1-2H3 |
| InChIKey | MVKQNTYUSMNSAD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|