C17H28O2 — CID 46781370
2-[4-(3,6-dimethylheptan-3-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]oxyethanol (PubChem CID 46781370) has the molecular formula C17H28O2 and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-[4-(3,6-dimethylheptan-3-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]oxyethanol.
| Compound Name | 2-[4-(3,6-dimethylheptan-3-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]oxyethanol |
|---|---|
| PubChem CID | 46781370 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 2-[4-(3,6-dimethylheptan-3-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]oxyethanol |
| SMILES | CCC(C)(CCC(C)C)[13c]1[13cH][13cH][13c](OCCO)[13cH][13cH]1 |
| InChI | InChI=1S/C17H28O2/c1-5-17(4,11-10-14(2)3)15-6-8-16(9-7-15)19-13-12-18/h6-9,14,18H,5,10-13H2,1-4H3/i6+1,7+1,8+1,9+1,15+1,16+1 |
| InChIKey | QRFCMJANHDRHEH-CJFYFUKZSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |