C24H24BCl3O3 — CID 172634152
6,6,6-tris(4-chlorophenyl)hexoxyboronic acid (PubChem CID 172634152) has the molecular formula C24H24BCl3O3 and a molecular weight of 477.62 g/mol. Its IUPAC name is 6,6,6-tris(4-chlorophenyl)hexoxyboronic acid.
| Compound Name | 6,6,6-tris(4-chlorophenyl)hexoxyboronic acid |
|---|---|
| PubChem CID | 172634152 |
| Molecular Formula | C24H24BCl3O3 |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 6,6,6-tris(4-chlorophenyl)hexoxyboronic acid |
| SMILES | OB(O)OCCCCCC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24BCl3O3/c26-21-10-4-18(5-11-21)24(19-6-12-22(27)13-7-19,20-8-14-23(28)15-9-20)16-2-1-3-17-31-25(29)30/h4-15,29-30H,1-3,16-17H2 |
| InChIKey | MKFQHHQRHPSHKV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|