C14H21BClN5O3 — CID 163282407
[5-amino-5-[1-[(1S)-1-(4-chlorophenyl)ethyl]tetrazol-5-yl]pentoxy]boronic acid (PubChem CID 163282407) has the molecular formula C14H21BClN5O3 and a molecular weight of 353.62 g/mol. Its IUPAC name is [5-amino-5-[1-[(1S)-1-(4-chlorophenyl)ethyl]tetrazol-5-yl]pentoxy]boronic acid.
| Compound Name | [5-amino-5-[1-[(1S)-1-(4-chlorophenyl)ethyl]tetrazol-5-yl]pentoxy]boronic acid |
|---|---|
| PubChem CID | 163282407 |
| Molecular Formula | C14H21BClN5O3 |
| Molecular Weight | 353.62 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [5-amino-5-[1-[(1S)-1-(4-chlorophenyl)ethyl]tetrazol-5-yl]pentoxy]boronic acid |
| SMILES | C[C@@H](c1ccc(Cl)cc1)n1nnnc1C(N)CCCCOB(O)O |
| InChI | InChI=1S/C14H21BClN5O3/c1-10(11-5-7-12(16)8-6-11)21-14(18-19-20-21)13(17)4-2-3-9-24-15(22)23/h5-8,10,13,22-23H,2-4,9,17H2,1H3/t10-,13?/m0/s1 |
| InChIKey | HITFTBNXGORYQR-NKUHCKNESA-N |
| XLogP | 1.09 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.62 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|