C16H25BN6O4 — CID 163282401
[5-amino-5-[1-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid (PubChem CID 163282401) has the molecular formula C16H25BN6O4 and a molecular weight of 376.23 g/mol. Its IUPAC name is [5-amino-5-[1-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid.
| Compound Name | [5-amino-5-[1-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid |
|---|---|
| PubChem CID | 163282401 |
| Molecular Formula | C16H25BN6O4 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | [5-amino-5-[1-[2-[(4-methylphenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]pentoxy]boronic acid |
| SMILES | Cc1ccc(CNC(=O)Cn2nnnc2C(N)CCCCOB(O)O)cc1 |
| InChI | InChI=1S/C16H25BN6O4/c1-12-5-7-13(8-6-12)10-19-15(24)11-23-16(20-21-22-23)14(18)4-2-3-9-27-17(25)26/h5-8,14,25-26H,2-4,9-11,18H2,1H3,(H,19,24) |
| InChIKey | IIOYAMSEWVRMMS-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|