C12H22BClN6O4 — CID 163282482
[6-amino-6-[1-[2-oxo-2-(prop-2-ynylamino)ethyl]tetrazol-5-yl]hexoxy]boronic acid;hydrochloride (PubChem CID 163282482) has the molecular formula C12H22BClN6O4 and a molecular weight of 360.61 g/mol. Its IUPAC name is [6-amino-6-[1-[2-oxo-2-(prop-2-ynylamino)ethyl]tetrazol-5-yl]hexoxy]boronic acid;hydrochloride.
| Compound Name | [6-amino-6-[1-[2-oxo-2-(prop-2-ynylamino)ethyl]tetrazol-5-yl]hexoxy]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 163282482 |
| Molecular Formula | C12H22BClN6O4 |
| Molecular Weight | 360.61 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [6-amino-6-[1-[2-oxo-2-(prop-2-ynylamino)ethyl]tetrazol-5-yl]hexoxy]boronic acid;hydrochloride |
| SMILES | C#CCNC(=O)Cn1nnnc1C(N)CCCCCOB(O)O.Cl |
| InChI | InChI=1S/C12H21BN6O4.ClH/c1-2-7-15-11(20)9-19-12(16-17-18-19)10(14)6-4-3-5-8-23-13(21)22;/h1,10,21-22H,3-9,14H2,(H,15,20);1H |
| InChIKey | YXKMGUJFVINVLK-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 148.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.61 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|