C12H23BN6O4 — CID 163282597
[5-amino-5-[1-(2-oxo-2-pyrrolidin-1-ylethyl)tetrazol-5-yl]pentoxy]boronic acid (PubChem CID 163282597) has the molecular formula C12H23BN6O4 and a molecular weight of 326.17 g/mol. Its IUPAC name is [5-amino-5-[1-(2-oxo-2-pyrrolidin-1-ylethyl)tetrazol-5-yl]pentoxy]boronic acid.
| Compound Name | [5-amino-5-[1-(2-oxo-2-pyrrolidin-1-ylethyl)tetrazol-5-yl]pentoxy]boronic acid |
|---|---|
| PubChem CID | 163282597 |
| Molecular Formula | C12H23BN6O4 |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [5-amino-5-[1-(2-oxo-2-pyrrolidin-1-ylethyl)tetrazol-5-yl]pentoxy]boronic acid |
| SMILES | NC(CCCCOB(O)O)c1nnnn1CC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H23BN6O4/c14-10(5-1-4-8-23-13(21)22)12-15-16-17-19(12)9-11(20)18-6-2-3-7-18/h10,21-22H,1-9,14H2 |
| InChIKey | ILPADJXPOXFVED-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|