C16H24BCl3N6O3 — CID 171057962
[6-amino-6-[1-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]hexyl]boronic acid;hydrochloride (PubChem CID 171057962) has the molecular formula C16H24BCl3N6O3 and a molecular weight of 465.58 g/mol. Its IUPAC name is [6-amino-6-[1-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]hexyl]boronic acid;hydrochloride.
| Compound Name | [6-amino-6-[1-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]hexyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 171057962 |
| Molecular Formula | C16H24BCl3N6O3 |
| Molecular Weight | 465.58 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [6-amino-6-[1-[2-[(2,4-dichlorophenyl)methylamino]-2-oxoethyl]tetrazol-5-yl]hexyl]boronic acid;hydrochloride |
| SMILES | Cl.NC(CCCCCB(O)O)c1nnnn1CC(=O)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H23BCl2N6O3.ClH/c18-12-6-5-11(13(19)8-12)9-21-15(26)10-25-16(22-23-24-25)14(20)4-2-1-3-7-17(27)28;/h5-6,8,14,27-28H,1-4,7,9-10,20H2,(H,21,26);1H |
| InChIKey | YPSMKVCJBHJAOZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|