C13H20BCl2N5O2 — CID 171057874
[5-amino-5-[1-[(3-chlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride (PubChem CID 171057874) has the molecular formula C13H20BCl2N5O2 and a molecular weight of 360.05 g/mol. Its IUPAC name is [5-amino-5-[1-[(3-chlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride.
| Compound Name | [5-amino-5-[1-[(3-chlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 171057874 |
| Molecular Formula | C13H20BCl2N5O2 |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [5-amino-5-[1-[(3-chlorophenyl)methyl]tetrazol-5-yl]pentyl]boronic acid;hydrochloride |
| SMILES | Cl.NC(CCCCB(O)O)c1nnnn1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H19BClN5O2.ClH/c15-11-5-3-4-10(8-11)9-20-13(17-18-19-20)12(16)6-1-2-7-14(21)22;/h3-5,8,12,21-22H,1-2,6-7,9,16H2;1H |
| InChIKey | HAZKFWICTPPEOZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|